* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(1-METHYLETHYL)-2-(1H-TETRAZOL-5-YL)-11H-PYRIDO(2,1-B)QUINAZOLIN-11-ONE |
CAS: | 126874-65-5 |
English Synonyms: | 8-(1-METHYLETHYL)-2-(1H-TETRAZOL-5-YL)-11H-PYRIDO(2,1-B)QUINAZOLIN-11-ONE |
MDL Number.: | MFCD01690085 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC(C)c1ccc2nc3ccc(cc3c(=O)n2c1)c4[nH]nnn4 |
InChi: | InChI=1S/C16H14N6O/c1-9(2)11-4-6-14-17-13-5-3-10(15-18-20-21-19-15)7-12(13)16(23)22(14)8-11/h3-9H,1-2H3,(H,18,19,20,21) |
InChiKey: | InChIKey=PLMCTCFGZLOZKC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.