* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | DEMECLOCYCLINE |
CAS: | 127-33-3 ;64-73-3 |
English Synonyms: | DEMECLOCYCLINE |
MDL Number.: | MFCD00864922 |
H bond acceptor: | 10 |
H bond donor: | 6 |
Smile: | CN(C)[C@H]1[C@@H]2C[C@@H]3[C@@H](c4c(ccc(c4C(=O)C3=C([C@@]2(C(=O)C(=C1O)C(=O)N)O)O)O)Cl)O |
InChi: | InChI=1S/C21H21ClN2O8/c1-24(2)14-7-5-6-10(16(27)12-9(25)4-3-8(22)11(12)15(6)26)18(29)21(7,32)19(30)13(17(14)28)20(23)31/h3-4,6-7,14-15,25-26,28-29,32H,5H2,1-2H3,(H2,23,31)/t6-,7-,14-,15-,21-/m0/s1 |
InChiKey: | InChIKey=FMTDIUIBLCQGJB-SEYHBJAFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.