* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | D-Tyrosine, 3-methyl- |
CAS: | 1270132-17-6 |
English Synonyms: | D-TYROSINE, 3-METHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC=1C=C(C[C@@H](N)C(=O)O)C=CC1O |
InChi: | InChI=1S/C10H13NO3/c1-6-4-7(2-3-9(6)12)5-8(11)10(13)14/h2-4,8,12H,5,11H2,1H3,(H,13,14)/t8-/m1/s1 |
InChiKey: | InChIKey=MQHLULPKDLJASZ-MRVPVSSYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.