* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-Bromo-5-fluoro-D-phenylalanine |
CAS: | 1270133-29-3 |
English Synonyms: | 3-BROMO-5-FLUORO-D-PHENYLALANINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC=1C=C(C[C@@H](N)C(=O)O)C=C(C1)F |
InChi: | InChI=1S/C9H9BrFNO2/c10-6-1-5(2-7(11)4-6)3-8(12)9(13)14/h1-2,4,8H,3,12H2,(H,13,14)/t8-/m1/s1 |
InChiKey: | InChIKey=FUHSSCCQGTWFBQ-MRVPVSSYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.