* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DL-Phenylalanine, 3-bromo-2-methyl- |
CAS: | 1270317-00-4 |
English Synonyms: | DL-PHENYLALANINE, 3-BROMO-2-METHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC=1C(=C(CC(N)C(=O)O)C=CC1)C |
InChi: | InChI=1S/C10H12BrNO2/c1-6-7(3-2-4-8(6)11)5-9(12)10(13)14/h2-4,9H,5,12H2,1H3,(H,13,14) |
InChiKey: | InChIKey=MDEANSZEMWDYLR-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.