Molecular Structure:
CAS No.:
127040-48-6
Product Name.:
CCD No.:CCD00241223
Formula:C17 H13 Cl N2
MolWeight:280.757
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 11H-PYRIDO(3,2-A)CARBAZOLE, 3-CHLORO-11-ETHYL- |
| CAS： | 127040-48-6 |
| English Synonyms： | 11H-PYRIDO(3,2-A)CARBAZOLE, 3-CHLORO-11-ETHYL- ; 3-CHLORO-11-ETHYL-11H-PYRIDO(3,2-A)CARBAZOLE |
| MDL Number.： | MFCD01690701 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | CCn1c2ccccc2c3c1c4ccc(nc4cc3)Cl |
| InChi： | InChI=1S/C17H13ClN2/c1-2-20-15-6-4-3-5-11(15)12-7-9-14-13(17(12)20)8-10-16(18)19-14/h3-10H,2H2,1H3 |
| InChiKey： | InChIKey=QMSCTDWMWZHLAQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
