* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-BROMO-2-METHYLDECANE |
CAS: | 127839-47-8 |
English Synonyms: | 1-BROMO-2-METHYLDECANE |
MDL Number.: | MFCD02258475 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCCCCCCCC(C)CBr |
InChi: | InChI=1S/C11H23Br/c1-3-4-5-6-7-8-9-11(2)10-12/h11H,3-10H2,1-2H3 |
InChiKey: | InChIKey=CFGVIMLEZTZTTI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.