* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (E)-4-(1-BUTENYL)-3,5-DIMETHYL-ISOXAZOLE |
CAS: | 128035-76-7 |
English Synonyms: | ISOXAZOLE, 4-(1-BUTENYL)-3,5-DIMETHYL-, (E)- ; (E)-4-(1-BUTENYL)-3,5-DIMETHYL-ISOXAZOLE |
MDL Number.: | MFCD18833061 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC/C=C/c1c(noc1C)C |
InChi: | InChI=1S/C9H13NO/c1-4-5-6-9-7(2)10-11-8(9)3/h5-6H,4H2,1-3H3/b6-5+ |
InChiKey: | InChIKey=FUHLLRNVIQPUCY-AATRIKPKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.