* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (Z)-4-(1-BUTENYL)-3,5-DIMETHYL-ISOXAZOLE |
CAS: | 128035-77-8 |
English Synonyms: | (Z)-4-(1-BUTENYL)-3,5-DIMETHYL-ISOXAZOLE ; ISOXAZOLE, 4-(1-BUTENYL)-3,5-DIMETHYL-, (Z)- |
MDL Number.: | MFCD18833060 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC/C=C\c1c(noc1C)C |
InChi: | InChI=1S/C9H13NO/c1-4-5-6-9-7(2)10-11-8(9)3/h5-6H,4H2,1-3H3/b6-5- |
InChiKey: | InChIKey=FUHLLRNVIQPUCY-WAYWQWQTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.