* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (Z)-3,5-DIMETHYL-4-(1-PENTENYL)-ISOXAZOLE |
CAS: | 128035-79-0 |
English Synonyms: | ISOXAZOLE, 3,5-DIMETHYL-4-(1-PENTENYL)-, (Z)- ; (Z)-3,5-DIMETHYL-4-(1-PENTENYL)-ISOXAZOLE |
MDL Number.: | MFCD18836285 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC/C=C\c1c(noc1C)C |
InChi: | InChI=1S/C10H15NO/c1-4-5-6-7-10-8(2)11-12-9(10)3/h6-7H,4-5H2,1-3H3/b7-6- |
InChiKey: | InChIKey=XOJHTSBHNLMVEJ-SREVYHEPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.