* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JM 244 |
CAS: | 129580-58-1 |
English Synonyms: | JM 244 |
MDL Number.: | MFCD00910603 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCCN.c1ccc(cc1)C(=O)O[Pt](OC(=O)c2ccccc2)(Cl)Cl.N |
InChi: | InChI=1S/2C7H6O2.C3H9N.2ClH.H3N.Pt/c2*8-7(9)6-4-2-1-3-5-6;1-2-3-4;;;;/h2*1-5H,(H,8,9);2-4H2,1H3;2*1H;1H3;/q;;;;;;+4/p-4 |
InChiKey: | InChIKey=CEIAKSIEJLYWAV-UHFFFAOYSA-J |
* If the product has intellectual property rights, a license granted is must or contact us.