* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(PYRIDIN-3-YL)AZEPANE |
CAS: | 130342-99-3 |
English Synonyms: | 2-(PYRIDIN-3-YL)AZEPANE ; ABBYPHARMA AP-17-5182 ; 2-(3-PYRIDINYL)AZEPANE |
MDL Number.: | MFCD02663702 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(cnc1)C2CCCCCN2 |
InChi: | InChI=1S/C11H16N2/c1-2-6-11(13-8-3-1)10-5-4-7-12-9-10/h4-5,7,9,11,13H,1-3,6,8H2 |
InChiKey: | InChIKey=BELIZRHOJQZKIU-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.