* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GI 129471 |
CAS: | 130370-59-1 |
English Synonyms: | GI 129471 |
MDL Number.: | MFCD00929641 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | CC(C)C[C@H]([C@H](CSc1ccccc1)C(=O)NO)C(=O)N[C@@H](Cc2ccccc2)C(=O)NC |
InChi: | InChI=1S/C25H33N3O4S/c1-17(2)14-20(21(24(30)28-32)16-33-19-12-8-5-9-13-19)23(29)27-22(25(31)26-3)15-18-10-6-4-7-11-18/h4-13,17,20-22,32H,14-16H2,1-3H3,(H,26,31)(H,27,29)(H,28,30)/t20-,21+,22+/m1/s1 |
InChiKey: | InChIKey=UBFGIEDUTRCMEQ-FSSWDIPSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.