* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | NSC 35051 |
| CAS: | 13045-94-8 |
| English Synonyms: | (2R)-2-AMINO-3-(4-[BIS(2-CHLOROETHYL)AMINO]PHENYL)PROPANOIC ACID ; NSC 35051 |
| MDL Number.: | MFCD01674289 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cc(ccc1C[C@H](C(=O)O)N)N(CCCl)CCCl |
| InChi: | InChI=1S/C13H18Cl2N2O2/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19/h1-4,12H,5-9,16H2,(H,18,19)/t12-/m1/s1 |
| InChiKey: | InChIKey=SGDBTWWWUNNDEQ-GFCCVEGCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.