* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (+/-)-5,6-EPOXY-5,6-DIHYDROQUINOLINE |
CAS: | 130536-37-7 |
English Synonyms: | (+/-)-5,6-EPOXY-5,6-DIHYDROQUINOLINE ; 1AH,7BH-OXIRENO[2,3-F]QUINOLINE |
MDL Number.: | MFCD02752067 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc2c(nc1)C=CC3C2O3 |
InChi: | InChI=1S/C9H7NO/c1-2-6-7(10-5-1)3-4-8-9(6)11-8/h1-5,8-9H |
InChiKey: | InChIKey=DUTMSHWTRSUNIF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.