* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DI-BOC-S-(2-AMINOETHYL)-L-CYSTEINE |
| CAS: | 130622-07-0 |
| English Synonyms: | DI-BOC-S-(2-AMINOETHYL)-L-CYSTEINE |
| MDL Number.: | MFCD12547716 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | CC(C)(C)OC(=O)NCCSC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
| InChi: | InChI=1S/C15H28N2O6S/c1-14(2,3)22-12(20)16-7-8-24-9-10(11(18)19)17-13(21)23-15(4,5)6/h10H,7-9H2,1-6H3,(H,16,20)(H,17,21)(H,18,19)/t10-/m0/s1 |
| InChiKey: | InChIKey=IEQFHDBZITZXMZ-JTQLQIEISA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.