Molecular Structure:
CAS No.:
13069-04-0
Product Name.:
CCD No.:CCD00449415
Formula:C5 H5 N O6 S2
MolWeight:239.227
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(16)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | PYRIDINE-3,5-DISULFONIC ACID |
| CAS： | 13069-04-0 |
| English Synonyms： | PYRIDINE-3,5-DISULFONIC ACID |
| MDL Number.： | MFCD04114215 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | c1c(cncc1S(=O)(=O)O)S(=O)(=O)O |
| InChi： | InChI=1S/C5H5NO6S2/c7-13(8,9)4-1-5(3-6-2-4)14(10,11)12/h1-3H,(H,7,8,9)(H,10,11,12) |
| InChiKey： | InChIKey=QRYROSZXZPINDI-UHFFFAOYSA-N |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
