* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-Aminomethyl-piperidin-2-one |
CAS: | 130762-29-7 |
English Synonyms: | 6-AMINOMETHYL-PIPERIDIN-2-ONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NCC1CCCC(N1)=O |
InChi: | InChI=1S/C6H12N2O/c7-4-5-2-1-3-6(9)8-5/h5H,1-4,7H2,(H,8,9) |
InChiKey: | InChIKey=KHOKAABYNKJTSO-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.