* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N1,5-Dimethylbenzene-1,2-diamine |
CAS: | 131019-87-9 |
English Synonyms: | N1,5-DIMETHYLBENZENE-1,2-DIAMINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CNC=1C(=CC=C(C1)C)N |
InChi: | InChI=1S/C8H12N2/c1-6-3-4-7(9)8(5-6)10-2/h3-5,10H,9H2,1-2H3 |
InChiKey: | InChIKey=ICWDURLIKIKGLQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.