* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-Indole-1-acetic acid, 7-fluoro- |
CAS: | 1313712-24-1 |
English Synonyms: | 1H-INDOLE-1-ACETIC ACID, 7-FLUORO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC=1C=CC=C2C=CN(C12)CC(=O)O |
InChi: | InChI=1S/C10H8FNO2/c11-8-3-1-2-7-4-5-12(10(7)8)6-9(13)14/h1-5H,6H2,(H,13,14) |
InChiKey: | InChIKey=XWRFQLMCZGCXQB-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.