* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-EPIMITOMYCIN B |
CAS: | 13164-90-4 |
English Synonyms: | 9-EPIMITOMYCIN B |
MDL Number.: | MFCD01757351 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | CC1=C(C(=O)C2=C(C1=O)N3C[C@H]4[C@@H]([C@@]3([C@@H]2COC(=O)N)O)N4C)OC |
InChi: | InChI=1S/C16H19N3O6/c1-6-11(20)10-9(12(21)13(6)24-3)7(5-25-15(17)22)16(23)14-8(18(14)2)4-19(10)16/h7-8,14,23H,4-5H2,1-3H3,(H2,17,22)/t7-,8+,14+,16-,18?/m1/s1 |
InChiKey: | InChIKey=UZUUQCBCWDBYCG-MMJOLYBUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.