* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-LEU-PHE-NH2 |
CAS: | 13171-96-5 |
English Synonyms: | Z-LEU-PHE-NH2 |
MDL Number.: | MFCD00238475 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC(C)C[C@@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N)NC(=O)OCc2ccccc2 |
InChi: | InChI=1S/C23H29N3O4/c1-16(2)13-20(26-23(29)30-15-18-11-7-4-8-12-18)22(28)25-19(21(24)27)14-17-9-5-3-6-10-17/h3-12,16,19-20H,13-15H2,1-2H3,(H2,24,27)(H,25,28)(H,26,29)/t19-,20-/m0/s1 |
InChiKey: | InChIKey=IYWAYHYSFZQCSH-PMACEKPBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.