* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-BENZO[D][1,3]OXAZIN-2(4H)-ONE |
CAS: | 13213-88-2 |
English Synonyms: | 1,4-DIHYDRO-2H-3,1-BENZOXAZIN-2-ONE ; 2,4-DIHYDRO-1H-3,1-BENZOXAZIN-2-ONE ; 1H-BENZO[D][1,3]OXAZIN-2(4H)-ONE |
MDL Number.: | MFCD01663880 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)COC(=O)N2 |
InChi: | InChI=1S/C8H7NO2/c10-8-9-7-4-2-1-3-6(7)5-11-8/h1-4H,5H2,(H,9,10) |
InChiKey: | InChIKey=SYZIUAAQNFJPJY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.