Molecular Structure:
CAS No.:
13213-88-2
Product Name.:
CCD No.:CCD00236465
Formula:C8 H7 N O2
MolWeight:149.148
![1H-BENZO[D][1,3]OXAZIN-2(4H)-ONE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(10)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(3)
|
|
| Product Name： | 1H-BENZO[D][1,3]OXAZIN-2(4H)-ONE |
| CAS： | 13213-88-2 |
| English Synonyms： | 1H-BENZO[D][1,3]OXAZIN-2(4H)-ONE ; 2,4-DIHYDRO-1H-3,1-BENZOXAZIN-2-ONE ; 1,4-DIHYDRO-2H-3,1-BENZOXAZIN-2-ONE |
| MDL Number.： | MFCD01663880 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | c1ccc2c(c1)COC(=O)N2 |
| InChi： | InChI=1S/C8H7NO2/c10-8-9-7-4-2-1-3-6(7)5-11-8/h1-4H,5H2,(H,9,10) |
| InChiKey： | InChIKey=SYZIUAAQNFJPJY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
