* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Dimethylamino-2,3-epoxypropane |
CAS: | 13222-40-7 |
English Synonyms: | 1-DIMETHYLAMINO-2,3-EPOXYPROPANE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CN(CC1CO1)C |
InChi: | InChI=1S/C5H11NO/c1-6(2)3-5-4-7-5/h5H,3-4H2,1-2H3 |
InChiKey: | InChIKey=TWJYXMZUQAMMKA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.