* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TRIPTOGELIN A-1 |
| CAS: | 132536-78-8 |
| English Synonyms: | TRIPTOGELIN A-1 |
| MDL Number.: | MFCD02752464 |
| H bond acceptor: | 11 |
| H bond donor: | 0 |
| Smile: | C[C@H]1C[C@H]([C@H]([C@]2([C@]13[C@@H]([C@@H]([C@@H]([C@@H]2OC(=O)c4ccccc4)OC(=O)c5ccccc5)C(O3)(C)C)OC(=O)C)C)OC(=O)c6ccccc6)OC(=O)c7ccccc7 |
| InChi: | InChI=1S/C45H44O11/c1-27-26-33(52-39(47)29-18-10-6-11-19-29)36(54-41(49)31-22-14-8-15-23-31)44(5)38(55-42(50)32-24-16-9-17-25-32)35(53-40(48)30-20-12-7-13-21-30)34-37(51-28(2)46)45(27,44)56-43(34,3)4/h6-25,27,33-38H,26H2,1-5H3/t27-,33+,34+,35-,36+,37+,38-,44+,45+/m0/s1 |
| InChiKey: | InChIKey=KAMRIYILCXXILS-IEPPWTTMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.