* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-PYRIDO(3,4-B)INDOLE, 2,3,4,9-TETRAHYDRO-1-(4-PIPERIDINYL)- |
CAS: | 132767-55-6 |
English Synonyms: | 1H-PYRIDO(3,4-B)INDOLE, 2,3,4,9-TETRAHYDRO-1-(4-PIPERIDINYL)- |
MDL Number.: | MFCD01690347 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | c1ccc2c(c1)c3c([nH]2)C(NCC3)C4CCNCC4 |
InChi: | InChI=1S/C16H21N3/c1-2-4-14-12(3-1)13-7-10-18-15(16(13)19-14)11-5-8-17-9-6-11/h1-4,11,15,17-19H,5-10H2 |
InChiKey: | InChIKey=MJGBDMLRTAFJSO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.