* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | D-Tyrosine, O-(2,4-difluorophenyl)- |
CAS: | 1335399-14-8 |
English Synonyms: | D-TYROSINE, O-(2,4-DIFLUOROPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC1=C(C=CC(=C1)F)OC1=CC=C(C[C@@H](N)C(=O)O)C=C1 |
InChi: | InChI=1S/C15H13F2NO3/c16-10-3-6-14(12(17)8-10)21-11-4-1-9(2-5-11)7-13(18)15(19)20/h1-6,8,13H,7,18H2,(H,19,20)/t13-/m1/s1 |
InChiKey: | InChIKey=SVHUSGRMFOCLHT-CYBMUJFWSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.