* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-O-METHYLURACIL-1-YL |
CAS: | 133762-82-0 |
English Synonyms: | 4-O-METHYLURACIL-1-YL |
MDL Number.: | MFCD02751951 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | COC1=NC(=O)[N]C=C1 |
InChi: | InChI=1S/C5H5N2O2/c1-9-4-2-3-6-5(8)7-4/h2-3H,1H3 |
InChiKey: | InChIKey=WVIYZAOZBCDLAX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.