* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-Piperidinol, 3-(1-methylethyl)- |
CAS: | 1339027-25-6 |
English Synonyms: | 3-PIPERIDINOL, 3-(1-METHYLETHYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(C)C1(CNCCC1)O |
InChi: | InChI=1S/C8H17NO/c1-7(2)8(10)4-3-5-9-6-8/h7,9-10H,3-6H2,1-2H3 |
InChiKey: | InChIKey=VCEXLAUZOSTXSQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.