* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Hexanamine, 6-(3-fluorophenoxy)- |
CAS: | 1339917-20-2 |
English Synonyms: | 1-HEXANAMINE, 6-(3-FLUOROPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC=1C=C(OCCCCCCN)C=CC1 |
InChi: | InChI=1S/C12H18FNO/c13-11-6-5-7-12(10-11)15-9-4-2-1-3-8-14/h5-7,10H,1-4,8-9,14H2 |
InChiKey: | InChIKey=IGFNBYOTBJNDLD-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.