* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-1,4-Diazepine-2,5-dione, tetrahydro-1-methyl- |
CAS: | 1342227-18-2 |
English Synonyms: | 1H-1,4-DIAZEPINE-2,5-DIONE, TETRAHYDRO-1-METHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CN1C(CNC(CC1)=O)=O |
InChi: | InChI=1S/C6H10N2O2/c1-8-3-2-5(9)7-4-6(8)10/h2-4H2,1H3,(H,7,9) |
InChiKey: | InChIKey=FTMJIPXEQUEBPF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.