* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-PHENYL-1H-1,2,4-TRIAZOLE |
| CAS: | 13423-60-4 |
| English Synonyms: | 1H-1,2,4-TRIAZOLE,1-PHENYL- ; 1-PHENYL-1H-1,2,4-TRIAZOLE ; 1-PHENYL-H-1,2,4-TRIAZOLE ; H-1,2,4-TRIAZOLE, 1-PHENYL- |
| MDL Number.: | MFCD01076193 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)n2cncn2 |
| InChi: | InChI=1S/C8H7N3/c1-2-4-8(5-3-1)11-7-9-6-10-11/h1-7H |
| InChiKey: | InChIKey=CGRLXLHYYDSTKR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.