* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Propanone, 1-[(3S)-3-amino-1-pyrrolidinyl]-2-methyl- |
CAS: | 1349971-75-0 |
English Synonyms: | 1-PROPANONE, 1-[(3S)-3-AMINO-1-PYRROLIDINYL]-2-METHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N[C@@H]1CN(CC1)C(C(C)C)=O |
InChi: | InChI=1S/C8H16N2O/c1-6(2)8(11)10-4-3-7(9)5-10/h6-7H,3-5,9H2,1-2H3/t7-/m0/s1 |
InChiKey: | InChIKey=JZFPVNLLUFKXKC-ZETCQYMHSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.