* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,1'-Biphenyl]-4-ethanol, 4'-(1,1-dimethylethyl)- |
CAS: | 1352153-51-5 |
English Synonyms: | [1,1'-BIPHENYL]-4-ETHANOL, 4'-(1,1-DIMETHYLETHYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(C)(C)C1=CC=C(C=C1)C1=CC=C(C=C1)CCO |
InChi: | InChI=1S/C18H22O/c1-18(2,3)17-10-8-16(9-11-17)15-6-4-14(5-7-15)12-13-19/h4-11,19H,12-13H2,1-3H3 |
InChiKey: | InChIKey=BGSJFBXNEVUGDX-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.