* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Glycine, N-[(2-iodophenyl)methyl]- |
CAS: | 1353977-48-6 |
English Synonyms: | GLYCINE, N-[(2-IODOPHENYL)METHYL]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | IC1=C(C=CC=C1)CNCC(=O)O |
InChi: | InChI=1S/C9H10INO2/c10-8-4-2-1-3-7(8)5-11-6-9(12)13/h1-4,11H,5-6H2,(H,12,13) |
InChiKey: | InChIKey=UBUCGDHIASPOAX-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.