* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(3,3,4,4,5,5,6,6,6-NONAFLUORO-1-IODOHEXYL)-2,8,9-TRIOXA-5-AZA-1-SILA BICYCLO(3.3.3)UNDECANE |
CAS: | 135587-13-2 |
English Synonyms: | 1-(3,3,4,4,5,5,6,6,6-NONAFLUORO-1-IODOHEXYL)-2,8,9-TRIOXA-5-AZA-1-SILA BICYCLO(3.3.3)UNDECANE |
MDL Number.: | MFCD01677728 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | C1CO[Si]2(OCCN1CCO2)C(CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)I |
InChi: | InChI=1S/C12H15F9INO3Si/c13-9(14,10(15,16)11(17,18)12(19,20)21)7-8(22)27-24-4-1-23(2-5-25-27)3-6-26-27/h8H,1-7H2 |
InChiKey: | InChIKey=LZXRMBONGPXFCO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.