* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | [1,1'-Biphenyl]-4-carboxaldehyde, 3',5'-dimethoxy- |
CAS: | 1356826-17-9 |
English Synonyms: | [1,1'-BIPHENYL]-4-CARBOXALDEHYDE, 3',5'-DIMETHOXY- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | COC=1C=C(C=C(C1)OC)C1=CC=C(C=C1)C=O |
InChi: | InChI=1S/C15H14O3/c1-17-14-7-13(8-15(9-14)18-2)12-5-3-11(10-16)4-6-12/h3-10H,1-2H3 |
InChiKey: | InChIKey=XVRFTFBGAHBGFF-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.