* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [2-(4-METHOXYPHENYL)ETHYL]UREA |
CAS: | 13576-85-7 |
English Synonyms: | [2-(4-METHOXYPHENYL)ETHYL]UREA |
MDL Number.: | MFCD01675975 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | COc1ccc(cc1)CCNC(=O)N |
InChi: | InChI=1S/C10H14N2O2/c1-14-9-4-2-8(3-5-9)6-7-12-10(11)13/h2-5H,6-7H2,1H3,(H3,11,12,13) |
InChiKey: | InChIKey=HMHATGJEFZCVSI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.