* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-isothiocyanato-1,3-dihydro-indol-2-one |
CAS: | 1360612-60-7 |
English Synonyms: | 5-ISOTHIOCYANATO-1,3-DIHYDRO-INDOL-2-ONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=C=S)C=1C=C2CC(NC2=CC1)=O |
InChi: | InChI=1S/C9H6N2OS/c12-9-4-6-3-7(10-5-13)1-2-8(6)11-9/h1-3H,4H2,(H,11,12) |
InChiKey: | InChIKey=KFFHDGQYDUXBMY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.