* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-THIOPHEN-2-YL-1H-IMIDAZOLE |
CAS: | 136103-77-0 |
English Synonyms: | 2-THIOPHEN-2-YL-1H-IMIDAZOLE ; 2-(2-THIENYL)-1H-IMIDAZOLE |
MDL Number.: | MFCD02677596 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(sc1)c2[nH]ccn2 |
InChi: | InChI=1S/C7H6N2S/c1-2-6(10-5-1)7-8-3-4-9-7/h1-5H,(H,8,9) |
InChiKey: | InChIKey=UZLSJAUHCCPJMC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.