* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,4,5,6,7,8-HEXAHYDRO-CYCLOHEPTA[B]PYRROLE |
CAS: | 13618-92-3 |
English Synonyms: | 1,4,5,6,7,8-HEXAHYDRO-CYCLOHEPTA[B]PYRROLE |
MDL Number.: | MFCD02823685 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1c[nH]c2c1CCCCC2 |
InChi: | InChI=1S/C9H13N/c1-2-4-8-6-7-10-9(8)5-3-1/h6-7,10H,1-5H2 |
InChiKey: | InChIKey=PSWWJFXURJCADQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.