* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Fmoc-N-methyl-DL-alanine |
CAS: | 1362858-88-5 |
English Synonyms: | FMOC-N-METHYL-DL-ALANINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OCC1C2=CC=CC=C2C2=CC=CC=C12)N(C(C)C(=O)O)C |
InChi: | InChI=1S/C19H19NO4/c1-12(18(21)22)20(2)19(23)24-11-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,12,17H,11H2,1-2H3,(H,21,22) |
InChiKey: | InChIKey=JOFHWKQIQLPZTC-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.