* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,3'-DITHIOL-4,4'-DIAMINO-BIPHENYL |
CAS: | 13730-46-6 |
English Synonyms: | 3,3'-DITHIOL-4,4'-DIAMINO-BIPHENYL |
MDL Number.: | MFCD02916373 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1cc(c(cc1c2ccc(c(c2)S)N)S)N |
InChi: | InChI=1S/C12H12N2S2/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6,15-16H,13-14H2 |
InChiKey: | InChIKey=VIZZYYXBVQTVQS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.