* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TIVIRAPINE |
| CAS: | 137332-54-8 |
| English Synonyms: | TIVIRAPINE |
| MDL Number.: | MFCD00914288 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C[C@H]1Cn2c3c(ccc(c3CN1CC=C(C)C)Cl)[nH]c2=S |
| InChi: | InChI=1S/C16H20ClN3S/c1-10(2)6-7-19-9-12-13(17)4-5-14-15(12)20(8-11(19)3)16(21)18-14/h4-6,11H,7-9H2,1-3H3,(H,18,21)/t11-/m0/s1 |
| InChiKey: | InChIKey=ZNFFMCYSMBXZQU-NSHDSACASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.