* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-Fmoc-N-hexyl-glycine |
CAS: | 1374785-50-8 |
English Synonyms: | N-FMOC-N-HEXYL-GLYCINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OCC1C2=CC=CC=C2C2=CC=CC=C12)N(CC(=O)O)CCCCCC |
InChi: | InChI=1S/C23H27NO4/c1-2-3-4-9-14-24(15-22(25)26)23(27)28-16-21-19-12-7-5-10-17(19)18-11-6-8-13-20(18)21/h5-8,10-13,21H,2-4,9,14-16H2,1H3,(H,25,26) |
InChiKey: | InChIKey=KKOUKNUFSDJJBV-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.