* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-Pyrrolidinol, 1-(3-oxetanyl)-, (3R)- |
CAS: | 1375415-98-7 |
English Synonyms: | 3-PYRROLIDINOL, 1-(3-OXETANYL)-, (3R)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | O1CC(C1)N1C[C@@H](CC1)O |
InChi: | InChI=1S/C7H13NO2/c9-7-1-2-8(3-7)6-4-10-5-6/h6-7,9H,1-5H2/t7-/m1/s1 |
InChiKey: | InChIKey=ORVAJNOIYUPTSI-SSDOTTSWSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.