* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EURYSTATIN B |
| CAS: | 137563-64-5 |
| English Synonyms: | EURYSTATIN B |
| MDL Number.: | MFCD01747869 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | CCC(C)CC/C=C/C(=O)NC1CCCNC(=O)C(NC(=O)C(=O)C(NC1=O)C)CC(C)C |
| InChi: | InChI=1S/C24H40N4O5/c1-6-16(4)10-7-8-12-20(29)27-18-11-9-13-25-22(31)19(14-15(2)3)28-24(33)21(30)17(5)26-23(18)32/h8,12,15-19H,6-7,9-11,13-14H2,1-5H3,(H,25,31)(H,26,32)(H,27,29)(H,28,33)/b12-8+ |
| InChiKey: | InChIKey=YNIGBMUXBCZRNQ-XYOKQWHBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.