Molecular Structure:
CAS No.:
13764-18-6
Product Name.:
CCD No.:CCD00032828
Formula:C14 H16
MolWeight:184.28
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(27)
- Buyers(0)
- Spectrum(0)
- MSDS(1)
- Price(9)
|
|
| Product Name： | 1,4,6,7-TETRAMETHYLNAPHTHALENE |
| CAS： | 13764-18-6 |
| English Synonyms： | 1,4,6,7-TETRAMETHYLNAPHTHALENE ; 1,4,6,7-TEMN |
| MDL Number.： | MFCD00049173 |
| H bond acceptor： | 0 |
| H bond donor： | 0 |
| Smile： | Cc1ccc(c2c1cc(c(c2)C)C)C |
| InChi： | InChI=1S/C14H16/c1-9-5-6-10(2)14-8-12(4)11(3)7-13(9)14/h5-8H,1-4H3 |
| InChiKey： | InChIKey=VPSPONOBLZCLIU-UHFFFAOYSA-N |
|
|
| Melting Point： | 63-64 DEG C |
| Comments： | HAZARD: R 36/37/38 HAZARD: S 26-37 IRRITANT TSCA: N UNSPSC: 12352005 |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
