* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DL-Phenylalanine, 3-ethoxy-N-Fmoc- |
CAS: | 1379879-99-8 |
English Synonyms: | DL-PHENYLALANINE, 3-ETHOXY-N-FMOC- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)OC=1C=C(CC(NC(=O)OCC2C3=CC=CC=C3C3=CC=CC=C23)C(=O)O)C=CC1 |
InChi: | InChI=1S/C26H25NO5/c1-2-31-18-9-7-8-17(14-18)15-24(25(28)29)27-26(30)32-16-23-21-12-5-3-10-19(21)20-11-4-6-13-22(20)23/h3-14,23-24H,2,15-16H2,1H3,(H,27,30)(H,28,29) |
InChiKey: | InChIKey=WPYSBWVXAWVARH-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.