* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | N-Fmoc-N-methyl-3-(1-naphthyl)-L-alanine |
CAS: | 1380327-68-3 |
English Synonyms: | N-FMOC-N-METHYL-3-(1-NAPHTHYL)-L-ALANINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OCC1C2=CC=CC=C2C2=CC=CC=C12)N([C@@H](CC1=CC=CC2=CC=CC=C12)C(=O)O)C |
InChi: | InChI=1S/C29H25NO4/c1-30(27(28(31)32)17-20-11-8-10-19-9-2-3-12-21(19)20)29(33)34-18-26-24-15-6-4-13-22(24)23-14-5-7-16-25(23)26/h2-16,26-27H,17-18H2,1H3,(H,31,32)/t27-/m0/s1 |
InChiKey: | InChIKey=MHVRUCBIMARVSP-MHZLTWQESA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.